Benzyl-d5 Bromide is a deuterium-labeled synthetic reagent, specifically This compound, used in chemical synthesis. Its primary significance lies in its role as a deuterated building block for introducing a benzyl group with five deuterium atoms, enabling mechanistic studies or isotopic labeling in research applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 71258-22-5
Copper(II) tosylate
Catalyst for organic synthesis
Diphenyl(4-(phenylthio)phenyl)sulfonium hexafluoroantimonate
Photoinitiator for cationic polymerization
2-Phenylbenzimidazole
sunscreen agent intermediate
Didecyl dimethyl ammonium chloride
Disinfectant and biocide
BENZYL BROMIDE
Organic synthesis intermediate for benzyl protecting group
Benzyl bromide-d7
deuterated research standard
1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene
AGEZXYOZHKGVCM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CBr)[2H])[2H]