This compound is a deuterium-labeled form of 4-aminobutanoic acid, specifically hexadeuterated at the carbon positions. It is primarily used as a stable isotope labeled analytical standard in research and laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 70607-85-1
Epsilon-Aminocaproic Acid-d10 Hydrochloride
research reagent for pharmacokinetic studies
3-((E)-((2-nitrophenyl)methylidene)amino)(2H4)-1,3-oxazolidin-2-one
stable isotope labeled analytical standard
Deschloroketamine
research compound
(S)-benzyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
3,3-dimethylbutanoyl chloride
research compound
1,3,5-tribromoadamantane
reference standard for impurity analysis
Gamma aminobütirik asit
active pharmaceutical ingredient
4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid
BTCSSZJGUNDROE-NMFSSPJFSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N