D-Aspartic acid, dimethyl ester, hydrochloride is a chemical compound commonly supplied as a research reagent. It is the hydrochloride salt form of the dimethyl ester derivative of D-aspartic acid and is used primarily in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 69630-50-8
Methyl 3-amino-6-bromopyrazine-2-carboxylate
chemical synthesis intermediate
4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine
Research compound for pharmacological studies
6-Chloro-1,3-dimethyluracil
Research compound for biochemical studies
1-Methyl-2-pyrrolecarboxylic acid
research compound
H-Asp(ome)-OMe HCl
amino acid ester research compound
dimethyl (2R)-2-aminobutanedioate;hydrochloride
PNLXWGDXZOYUKB-PGMHMLKASA-N
COC(=O)C[C@H](C(=O)OC)N.Cl