This compound is a pharmaceutical intermediate featuring a piperazine ring and a trifluoromethyl-substituted aniline moiety. It is primarily used in the synthesis of other pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 694499-26-8
Ethyl hydrazinoacetate hydrochloride
Pharmaceutical intermediate for drug synthesis
(-)-Isopinocampheylamine
Pharmaceutical intermediate
3'-Chloro-4'-aminoacetophenone
Pharmaceutical intermediate for synthesis
Ethyl 2-(diphenylmethyleneamino)acetate
Pharmaceutical intermediate for glycine derivatives
1-Nitroso-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
nitrosamine impurity standard
4-[(4-methylpiperazin-1-yl)methyl]benzoic Acid Dihydrochloride
pharmaceutical intermediate
4-[(4-methyl-1-piperazinyl)methyl]benzoyl chloride dihydrochloride
pharmaceutical intermediate
4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline
ZMWAZMYBMAAMAW-UHFFFAOYSA-N
CN1CCN(CC1)CC2=C(C=C(C=C2)N)C(F)(F)F