1-Nitroso-L-tryptophan is a nitrosamine impurity reference standard derived from the amino acid tryptophan. It is primarily used as a reference compound in the research and quality control of pharmaceutical materials to detect and quantify nitrosamine impurities.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 68807-89-6
Allyl (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-aminobutanoate
peptide synthesis building block
AFLATOXIN M2
mycotoxin reference standard
4-(difluoromethoxy)benzeneboronic acid
Boronic acid research reagent
Dithioerythritol
Reducing agent for disulfides
(2S)-2-amino-3-(1-nitrosoindol-3-yl)propanoic acid
WBQJTPDOGLYTBE-VIFPVBQESA-N
C1=CC=C2C(=C1)C(=CN2N=O)C[C@@H](C(=O)O)N