Ethyl Pyruvate-3,3,3-d3 is a deuterated research compound labeled with three deuterium atoms at the methyl group. It is primarily used as a stable isotope internal standard in analytical chemistry and metabolic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 66966-38-9
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
2-BROMOPYRIDINE-D4
Deuterated research compound
4-Bromobenzoic-d4 Acid
Deuterated research compound
2-Hydroxy Estrone-d4
Deuterated research compound
(9H-Fluoren-9-yl)methyl 2-(aminomethyl)piperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
3-Aminomethyl-1-N-Fmoc-piperidine hydrochloride
Research reagent for peptide synthesis
4-(1-(tert-butoxycarbonyl)-1H-pyrrol-2-yl)benzoic acid
research compound
4,6-dibromodibenzothiophene
research compound for binuclear platinum complexes
ethyl 3,3,3-trideuterio-2-oxopropanoate
XXRCUYVCPSWGCC-BMSJAHLVSA-N
[2H]C([2H])([2H])C(=O)C(=O)OCC