5-Methoxy-1H-indole-3-ethylamine hydrochloride is a research compound supplied in salt form. It is structurally related to certain indole derivatives and is categorized as a Schedule I controlled substance under the US Controlled Substances Act, indicating high potential for abuse and no accepted medical use in the United States.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 66-83-1
5-METHOXYTRYPTAMINE
serotonergic receptor agonist tool compound
5-Aminovaleric acid
research compound and metabolite standard
L-norvaline
hypoglycemic and neuroprotective research compound
Triphenylsulfonium triflate
Photoacid generator for photoresists
Somatotropin (176-191)
research reagent
2-(5-methoxy-1H-indol-3-yl)ethanamine;hydrochloride
TXVAYRSEKRMEIF-UHFFFAOYSA-N
COC1=CC2=C(C=C1)NC=C2CCN.Cl