4-Amino-2-(trifluoromethyl)benzonitrile is a research compound featuring an aromatic ring substituted with an amino group, a nitrile group, and a trifluoromethyl group. It is primarily used as a laboratory reagent in chemical synthesis and research applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 654-70-6
4-Amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide hydrochloride
research compound
Cyclopropylacetonitrile
research compound
2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid
research compound
2,4-Diaminobutyric acid dihydrochloride, (+-)-
Research reagent for biochemical studies
4-amino-2-(trifluoromethyl)benzonitrile
PMDYLCUKSLBUHO-UHFFFAOYSA-N
C1=CC(=C(C=C1N)C(F)(F)F)C#N