2,3,5,6-Tetrafluoroterephthalic acid is a fluorinated aromatic dicarboxylic acid used as an industrial chemical intermediate. Its structure features a benzene ring substituted with four fluorine atoms and two carboxylic acid groups, making it a building block for specialty polymers and other advanced materials.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 652-36-8
Pentafluorobenzoic acid
Synthetic polymer MALDI matrix compound
Tetrafluoro-4-hydroxybenzoic acid
Organic synthesis intermediate
4-(trans-4-n-Propylcyclohexyl)benzoic acid
Liquid crystal intermediate
2,6-Dimethylhydroquinone
hydroquinone derivative intermediate
4-Nitro-2-(trifluoromethyl)anisole
chemical intermediate for synthesis
1,8-DIMETHYL-9H-CARBAZOLE
Electronic chemical intermediate
2,3,5,6-tetrafluoroterephthalic acid
WFNRNCNCXRGUKN-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)C(=O)O)F)F)C(=O)O