Testosterone sulfate is a steroid sulfate derivative of testosterone, featuring a sulfoxy group at the 17-position. It is recognized as a naturally occurring human urinary metabolite and is utilized in research related to metabolic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 651-45-6
4-Hydroxycyclohexanecarboxylic acid
human urinary metabolite research
Glycine, L-cysteinyl-L-asparaginylglycyl-L-arginyl-L-cysteinyl-
research compound
2-Bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
cross-coupling reagent for synthesis
H-Gly-Arg-AMC
fluorogenic enzyme substrate for peptidase assay
6-bromoquinoline-2-carboxylic acid
research compound
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate
WAQBISPOEAOCOG-DYKIIFRCSA-N
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=CC(=O)CC[C@]34C