Boc-N-Me-Tyr(Bzl)-OH is a protected derivative of N-methyltyrosine used in peptide synthesis research. Its structure includes a tert-butoxycarbonyl (Boc) protecting group on the amine and a benzyl ether on the tyrosine side chain.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 64263-81-6
Boc-N-Me-Phe-OH
protected amino acid building block
Tetrahydropapaverine hydrochloride
research compound
Acetaminophen-d4 (major)
deuterated internal standard
N-{9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-6,9-dihydro-1H-purin-2-yl}-2-methylpropanamide
purine nucleoside for research
N-Benzylglycine ethyl ester
research compound
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid
FSNRGORPOYPIJC-IBGZPJMESA-N
CC(C)(C)OC(=O)N(C)[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O