4-Chlorobenzaldehyde-2,3,5,6-d4 is a deuterated research standard used primarily in analytical chemistry and laboratory research. Its structure features a benzene ring with a chlorine substituent and an aldehyde group, with all four aromatic hydrogen atoms replaced by deuterium, making it suitable for isotope-labeled studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 62285-59-0
Glycine ethyl ester, hydrochloride
research reagent
Ethyl propiolate
Organic synthesis reagent
ETHYL IODOACETATE
Lachrymatory research reagent
Ethyl diazoacetate
laboratory reagent for organic synthesis
4-Chlorobenzaldehyde
intermediate for dyes and pharmaceuticals
4-chloro-2,3,5,6-tetradeuteriobenzaldehyde
AVPYQKSLYISFPO-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Cl)[2H]
—