2,2,2-Trifluoroethyl trifluoromethanesulfonate is a fluorinated chemical compound used primarily as a pharmaceutical intermediate. Its significance lies in its role in the synthesis of drug compounds, particularly those requiring trifluoroethyl group incorporation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6226-25-1
Propyltriphenylphosphonium bromide
pharmaceutical intermediate
Cyclopropanecarboxamide
pharmaceutical intermediate for prasugrel
((2E,4E)-3-Methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dien-1-yl)triphenylphosphonium bromide
intermediate for acitretin synthesis
4-Aminobenzyl alcohol
pharmaceutical intermediate
2,2,2-trifluoroethyl trifluoromethanesulfonate
RTMMSCJWQYWMNK-UHFFFAOYSA-N
C(C(F)(F)F)OS(=O)(=O)C(F)(F)F