2-Bromo-N-phenylaniline is a chemical compound commonly used as a research reagent. It features an amine functional group, two aromatic rings, and a bromine substituent, contributing to its utility in laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 61613-22-7
Tri-o-tolylphosphine
phosphine ligand for catalysis
2-Thiopheneboronic acid
Boronic acid building block for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Boron reagent for organic synthesis
2-bromo-N-phenylaniline
WAAWAHYRHUWAFM-UHFFFAOYSA-N
C1=CC=C(C=C1)NC2=CC=CC=C2Br