3-Methoxycinnamic acid is a research reagent studied for its behavior in photodimerization reactions, particularly in single-crystal environments. Its significance lies in its use as a model compound to investigate the solid-state photochemical transformations of substituted cinnamic acids.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6099-04-3
5'-adenylic acid
biochemical research reagent
4-Nitrophthalic acid
Research compound
2,4-DINITROBENZOIC ACID
organic synthesis research reagent
1-Aminoanthracene
Fluorescent general anesthetic
(E)-3-(3-methoxyphenyl)prop-2-enoic acid
LZPNXAULYJPXEH-AATRIKPKSA-N
COC1=CC=CC(=C1)/C=C/C(=O)O