This compound is the dimeric form of the amino acid homocysteine. It is primarily used as a research reagent and biomarker for homocystinuria, particularly in studies related to cystathionine beta-synthase deficiency.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6027-15-2
D-Homoserine
research compound
Hordenine hydrochloride
research compound for alkaloid studies
4-chloro-1H-pyrrolo[3,2-c]pyridine
research compound
3-Nitrophthalic acid
crystallographic research reagent
L-Homocystine
biochemical research reagent
4,4'-Dithiobis(2-aminobutyric acid)
research compound
(2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid
ZTVZLYBCZNMWCF-PHDIDXHHSA-N
C(CSSCC[C@H](C(=O)O)N)[C@H](C(=O)O)N