2-Bromo-1-phenylhexan-1-one is a chemical compound used as a research reagent. It features a bromine atom and a phenyl ring, contributing to its utility in laboratory synthesis and investigation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 59774-06-0
2-bromo-1-phenyl-pentan-1-one
pharmaceutical intermediate
5-cyanothiophene-2-carboxylic acid
research compound
2,4,6-Trimethylbenzeneboronic acid
Research reagent for organic synthesis
(1,3-Bis(diphenylphosphino)propane)palladium(II) chloride
catalyst for cross-coupling reactions
8-Azaxanthine monohydrate
Research reagent for biochemical studies
2-bromo-1-phenylhexan-1-one
MQIJCWVCTPNMKW-UHFFFAOYSA-N
CCCCC(C(=O)C1=CC=CC=C1)Br