(S)-3-Phenylpiperidine is a chiral piperidine derivative used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring and a secondary amine, with a single stereocenter that defines its specific three-dimensional arrangement.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 59349-71-2
(R)-3-Phenyl-pyrrolidine hydrochloride
research compound
N-(4-Bromopentyl)phthalimide
pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol
pharmaceutical intermediate
Methyl 2-methyl-3-nitrobenzoate
Pharmaceutical intermediate
3-Phenylpiperidine
Research compound
(R)-3-Phenylpiperidine
research compound
(R)-3-Phenylpiperidine hydrochloride
Pharmaceutical intermediate
(3S)-3-phenylpiperidine
NZYBILDYPCVNMU-LLVKDONJSA-N
C1C[C@H](CNC1)C2=CC=CC=C2