This compound is a sulfonium salt used as a cationic photoinitiator, typically supplied as the hexafluorophosphate salt. It is designed to initiate cationic polymerization upon exposure to ultraviolet light, making it significant in UV-curable coatings and inks.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 591773-92-1
Triphenylsulfonium hexafluorophosphate
Cationic photoinitiator
1-HEXENE
Chemical intermediate and comonomer
2-Bromoethyl ethyl ether
chemical intermediate and insecticide precursor
Hepten
Organic synthesis intermediate
3-Hexadecanol
secondary fatty alcohol
10-(4-phenylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one hexafluorophosphate
UHKYZKDZFIFLBK-UHFFFAOYSA-N
CC(C)C1=CC2=C(C=C1)[S+](C3=CC=CC=C3C2=O)C4=CC=C(C=C4)C5=CC=CC=C5.F[P-](F)(F)(F)(F)F