This compound is a protected amino acid intermediate, specifically the tert-butyl ester and O-tert-butyl ether derivative of L-threonine, presented as an acetic acid salt. It is primarily used in peptide synthesis as a building block for introducing threonine residues with protected side chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 5854-77-3
1,2-DI-TERT-BUTYL (2S,4S)-4-HYDROXYPYRROLIDINE-1,2-DICARBOXYLATE
Protected amino acid intermediate
N-Boc-glycine Methyl Ester
Protected amino acid intermediate
Z-TYR(TBU)-OME
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
(S)-(+)-2-Amino-1-butanol
pharmaceutical intermediate
2,2-Dimethylbutyryl chloride
Pharmaceutical intermediate for synthesis
Ethyl 2,6-dichloronicotinate
Pharmaceutical and agrochemical intermediate
(s)-3-aminobutanoic acid hydrochloride
GABA analogue intermediate
acetic acid;tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate
BGAUVMFJRASONL-RJUBDTSPSA-N
C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC(C)(C)C.CC(=O)O