Methyl olivetolate is a chemical compound used as a pharmaceutical intermediate. It features a pentyl-substituted aromatic ring with hydroxyl groups and an ester functional group, contributing to its role in chemical synthesis for pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 58016-28-7
Ethyl 2,4-dihydroxy-6-pentylbenzoate
Lisdexamfetamine intermediate
6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedione
Pharmaceutical impurity reference standard
2-Naphthylacetic acid
pharmaceutical intermediate
Tert-Butyl 1-amino-3,6,9,12-tetraoxapentadecan-15-oate
Polyethylene glycol linker for bioconjugation
1-(4-(3-Chloropropoxy)-3-methoxyphenyl)ethanone
Iloperidone intermediate
methyl 2,4-dihydroxy-6-pentylbenzoate
RQGAOBDPFOADCM-UHFFFAOYSA-N
CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC