meso-Hydrobenzoin is a chemical compound with two alcohol groups and two aromatic rings, commonly used as a research compound in laboratory settings. Its structure features defined stereochemistry, and it is primarily supplied for research and development purposes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 579-43-1
2-Methylpyridine-4-boronic acid
Boronic acid research reagent
ACEQUINOCYL-HYDROXY
reference standard
6-Amino-2,3-dimethylpyridine
research compound for chemical synthesis
4,4,4-trifluoro-1-(3-methoxyphenyl)-1,3-butanedione
research compound
(1S,2S)-1,2-diphenylethane-1,2-diol
Pharmaceutical intermediate
(1R,2R)-1,2-diphenylethane-1,2-diol
pharmaceutical intermediate
(1R,2S)-(-)-2-Amino-1,2-diphenylethanol
Intermediates for chiral pharmaceutical synthesis
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
(1R,2S)-1,2-diphenylethane-1,2-diol
IHPDTPWNFBQHEB-OKILXGFUSA-N
C1=CC=C(C=C1)[C@H]([C@H](C2=CC=CC=C2)O)O