Alpha-Methyl-D-Tryptophan is a research compound structurally related to the amino acid tryptophan, which is involved in protein biosynthesis and serves as a precursor to serotonin, melatonin, and niacin. This derivative is primarily used in laboratory studies to investigate tryptophan metabolism and related biochemical pathways.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 56452-52-9
Furo[3,2-b]pyridine-5-carboxylic acid
research compound
3-aminothiophene-2-carbonitrile
research compound
1,1-dimethyl-2-(4-methoxyphenyl)ethylamine hydrochloride
pharmaceutical research intermediate
1-(4-methoxyphenyl)-2-methylpropan-2-amine
research compound
Alpha-Methyl-L-tryptophan
research compound for tryptophan metabolism studies
(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid
ZTTWHZHBPDYSQB-GFCCVEGCSA-N
C[C@@](CC1=CNC2=CC=CC=C21)(C(=O)O)N