Alverine citrate is a salt form of alverine, a compound used as a pharmaceutical raw material. It functions as a smooth muscle relaxant, affecting involuntary muscles in the gastrointestinal tract.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 5560-59-8
N-Phenylpropyl Alverine Hydrochloride
smooth muscle relaxant drug
3-Phenyl-N,N-bis(3-phenylpropyl)propan-1-amine
research compound
Tandetoron
pharmaceutical active ingredient
Nimustine hydrochloride
active pharmaceutical ingredient
Lumbokinase capsules
active pharmaceutical ingredient
Cephalonium
veterinary cephalosporin antibiotic
Alverine Impurity 19
nitrosamine reference standard
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid
RYHCACJBKCOBTJ-UHFFFAOYSA-N
CCN(CCCC1=CC=CC=C1)CCCC2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O