Diphenyl(pentafluorophenyl)phosphine is a phosphine ligand used in coordination chemistry. Its structure features a phosphorus atom bonded to two phenyl rings and a pentafluorophenyl group, giving it distinct electronic properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 5525-95-1
Nicotinic acid hydrazide
research compound
Hexanoic-2,2-d2 acid
deuterated research compound
Caproic acid-6,6,6-d3
deuterated reference standard for analytical chemistry
Phenyl vinyl sulfone
Research reagent for organic synthesis
(2,3,4,5,6-pentafluorophenyl)-diphenylphosphane
KUTXTUCJQJPJBH-UHFFFAOYSA-N
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C(=C(C(=C3F)F)F)F)F