Citrulline malate is a salt combination of the amino acid citrulline and malic acid. It is recognized as a nutritional ingredient used for its potential anti-fatigue properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 54940-97-5
Citrulline malate
anti-fatigue compound
L-citrulline
nutritional supplementation
L-Homocitrulline
research compound
Psicopyranose
functional sugar
Glycerol trimyristate
Food ingredient from natural oils
Guanosine 5'-monophosphate disodium salt
flavor enhancer food additive
Acesulfame potassium
Artificial sweetener
(2R)-2-amino-5-(carbamoylamino)pentanoic acid
Research compound
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid
DROVUXYZTXCEBX-WCCKRBBISA-N
C(C[C@@H](C(=O)O)N)CNC(=O)N.C(C(C(=O)O)O)C(=O)O