This compound is a brominated methoxynaphthalene derivative commonly used as a research reagent in organic synthesis and laboratory studies. Its structure features an aromatic ring system with a bromine atom and a methoxy group, contributing to its moderate lipophilicity and low polarity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 54828-63-6
Diethyl Methyl-d3-malonate
Deuterated malonate ester research reagent
6-Chloro-N,N-dimethylnicotinamide
research compound
DL-2,3-Diaminopropionic acid hydrochloride
Proteomics research reagent
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
6-bromo-1-methoxynaphthalene
SKRSSNLRBLWLCE-UHFFFAOYSA-N
COC1=CC=CC2=C1C=CC(=C2)Br