Octaphenylcyclotetrasiloxane is a cyclic organosilicon compound primarily utilized as a precursor in the production of silicone materials. Its structure features eight phenyl groups attached to a siloxane ring, contributing to its non-polar character and high molecular weight.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 546-56-5
Titanium(IV) isopropoxide
Polymerization catalyst and paint additive
2-Methyl-3-nitrophenol
chemical intermediate for synthesis
Hydroxylamine hydrochloride
Organic synthesis reagent
2-acetoxy-1-ethoxypropane
Solvent in industrial coatings
2,2,4,4,6,6,8,8-octakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane
VSIKJPJINIDELZ-UHFFFAOYSA-N
C1=CC=C(C=C1)[Si]2(O[Si](O[Si](O[Si](O2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9