[1,1'-Biphenyl]-4-ylmethyl acrylate is a research compound used primarily in laboratory and manufacturing settings. It features an ester functional group linking an acrylate moiety to a biphenyl ring system, imparting moderate lipophilicity and low polarity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 54140-58-8
Benzyl acrylate
polymerization monomer for acrylic resins
1,3,7-Trimethyluric acid
research compound
2-Hydroxy-5-nitropyridine
research compound
6-chloro-N-methylnicotinamide
research compound
3-oxopentanedioic acid
organic synthesis intermediate
(4-phenylphenyl)methyl prop-2-enoate
QBECDXJGYFRACA-UHFFFAOYSA-N
C=CC(=O)OCC1=CC=C(C=C1)C2=CC=CC=C2