4-Bromo-3-nitrotoluene is a research compound that features a bromine atom and a nitro group on a toluene ring. Its structure is relevant for studying the ortho effect in substituted benzene compounds, a phenomenon that influences chemical properties through steric and polar interactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 5326-34-1
N-(4-methyl-2-pyridyl)acetamide
chemical research intermediate
2-ACETAMIDO-6-METHYLPYRIDINE
research compound
5-Hexynoic acid
terminal acetylenic compound for research
(2R,3R,4S,5R)-2-[6-amino-2-(phenylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol
Research nucleoside analog
1-bromo-4-methyl-2-nitrobenzene
UPBUTKQMDPHQAQ-UHFFFAOYSA-N
CC1=CC(=C(C=C1)Br)[N+](=O)[O-]