This compound is a deuterated form of tert-butanol, where all hydrogen atoms in the methyl groups and the hydroxyl group are replaced with deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of deuterated active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 53001-22-2
4-Amino-6-chloropyrimidine
Pharmaceutical intermediate
(2,3,4,5-tetrafluorophenyl)methanol
Pharmaceutical intermediate synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
3-(4,5-Dihydro-1H-imidazol-2-yl)aniline monohydrochloride
pharmaceutical intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
2-Methyl-2-propan-d9-ol
Deuterated chemical intermediate for synthesis
2-Methylpropan-2-(2H)ol
Deuterated research reagent
1,1,1,3,3,3-hexadeuterio-2-deuteriooxy-2-(trideuteriomethyl)propane
DKGAVHZHDRPRBM-SGLLWXCUSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H]