Tinuvin 770 is a hindered amine light stabilizer (HALS) used to protect plastics and coatings from oxidation caused by sunlight exposure. Its active form functions as an aminoxyl radical, which scavenges free radicals to prevent polymer degradation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 52829-07-9
O-Tolunitrile
Chemical intermediate for synthesis
3-Ethyl-4-methylpyridine
chemical intermediate
1-TETRALONE
Solvent and chemical intermediate
Tert-Butyl bromoacetate
Chemical synthesis intermediate
Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester, mixt. with 1-methyl 10-(1,2,2,6,6-pentamethyl-4-piperidinyl) decanedioate
hindered amine light stabilizer
Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate
UV stabilizer
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate
XITRBUPOXXBIJN-UHFFFAOYSA-N
CC1(CC(CC(N1)(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(NC(C2)(C)C)(C)C)C