1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt is a research reagent commonly used as a colorimetric or complexometric agent for the detection and determination of cobalt and potassium ions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 525-05-3
Tris (dibenzylideneaceton)dipalladum (O) chloroform adduct
organometallic catalyst for coupling reactions
2-Iodo-5-methylbenzoic acid
research reagent
Cholenic acid
research compound
5-Chloro-1-pentanol
Halogenated alcohol research reagent
disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate
DMKMTGULLYISBH-UHFFFAOYSA-L
C1=CC2=C(C(=C(C=C2C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O)N=O.[Na+].[Na+]