6-Bromo-L-tryptophan is a halogenated derivative of the amino acid L-tryptophan. It is commonly used as a research compound, particularly in studies involving the kynurenine pathway, which is the major route of tryptophan metabolism.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 52448-17-6
AFMK
Metabolite of melatonin and antioxidant
Dichloro(p-cymene)ruthenium(II) dimer
organometallic chemistry and homogeneous catalysis reagent
Dichloro(mesitylene)ruthenium(II) dimer
organoruthenium reagent for catalysis
2-(4-Bromophenyl)naphtho[1,2-d]oxazole
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
(R)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
Peptide building block for research
(2S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
OAORYCZPERQARS-VIFPVBQESA-N
C1=CC2=C(C=C1Br)NC=C2C[C@@H](C(=O)O)N