Taurodehydrocholate is a bile acid derivative used primarily as a research reagent in the study of bile acid chemistry and metabolism. Its structure includes a steroid backbone with multiple ketone groups and a taurine conjugate, making it a valuable tool for laboratory investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 517-37-3
Glycodehydrocholic acid
bile acid glycine conjugate
2-METHYL-D3-1,4-NAPHTHOQUINONE
deuterated analytical reference standard
2-amino-1-(pyridin-3-yl)ethanone
research compound
5-Amino-2,4-dichloropyrimidine
Chemical research compound
Dimidium bromide
research compound
Dehydrocholic acid
pharmaceutical raw material
Sodium dehydrocholate
bile acid
2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid
UBDJSBRKNHQFPD-PYGYYAGESA-N
C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C