Methyl O-tert-butyl-L-tyrosinate hydrochloride is a protected derivative of the amino acid tyrosine, commonly used in peptide synthesis. It features a tert-butyl ether protecting group on the phenolic oxygen and a methyl ester on the carboxyl group, supplied as a hydrochloride salt.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 51482-39-4
O-tert-Butyl-L-tyrosine
pharmaceutical intermediate for peptide synthesis
4-Hydroxy-3-pyridinesulfonic acid
Pharmaceutical intermediate for API synthesis
T-Boc-aminocaproic-N-hydroxysuccinimide
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride
PAFVAMWJVIIMQK-YDALLXLXSA-N
CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC)N.Cl