This compound is a chemical compound containing a benzodiazepine core structure, featuring amide and amine functional groups along with an aromatic halogen atom. It is primarily recognized as an intermediate in the synthesis of pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 50892-62-1
1-Chloroethyl chloroformate
Pharmaceutical intermediate for synthesis
3-(bromomethyl)benzamide
Pharmaceutical intermediate
4-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)benzene-1-sulfonyl chloride
Pharmaceutical intermediate for valdecoxib synthesis
Ambroxol impurity c
Pharmaceutical reference standard impurity
8-Chloro-5,10-dihydro-5-nitroso-11H-dibenzo[b,e][1,4]diazepin-11-one
Nitroso impurity reference standard
3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
YVWNDABPZGGQFE-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl