This compound is a protected amino acid derivative used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a benzyl group on the cysteine side chain, making it suitable for solid-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 5068-28-0
N-alpha-t-Butyloxycarbonyl-S-(4-methyl-benzyl)-L-cysteine
research reagent for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
Methyl 3-methoxy-4-nitrobenzoate
pharmaceutical intermediate
(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
IFVORPLRHYROAA-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O