4-Methyl-D-phenylalanine is a non-proteinogenic amino acid derivative with a methyl substituent on the aromatic ring. It serves as a specialized peptide building block in solid-phase synthesis, primarily for incorporating D-stereochemistry into peptide chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 49759-61-7
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
Scopine
pharmaceutical intermediate
Isonipecotic acid
pharmaceutical intermediate
2-Azabicyclo[2.2.1]hept-5-en-3-one
Pharmaceutical intermediate for abacavir synthesis
Mercaptopurine disulfide
Pharmaceutical intermediate for thiopurine derivatives
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2R)-2-amino-3-(4-methylphenyl)propanoic acid
DQLHSFUMICQIMB-SECBINFHSA-N
CC1=CC=C(C=C1)C[C@H](C(=O)O)N