4,4',4''-Trimethoxytrityl chloride is a chemical compound used as a protecting group reagent for alcohols in organic synthesis. It features a trityl core with three methoxy substituents, providing stability and selectivity for protecting hydroxyl groups during complex molecule assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 49757-42-8
P-(Chlorodiphenylmethyl)anisole
Pharmaceutical intermediate for oligonucleotide synthesis
1,1'-(Chlorophenylmethylene)bis(4-methoxybenzene)
protecting group reagent
Trityl chloride
Protecting group reagent for alcohols
Tert-Butyl 1H-imidazole-1-carboxylate
synthetic intermediate for Boc protection
Nipecotic acid
GABA reuptake inhibitor
4-Hydroxy-3-methylbenzoic acid
human blood serum metabolite research
Pyridine-2,4-dicarboxylic acid
enzyme inhibitor research compound
1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene
OBFCMKPFILBCSQ-UHFFFAOYSA-N
COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)(C3=CC=C(C=C3)OC)Cl
—