Mandyphos SL-M004-1 is a chiral ligand used in asymmetric catalysis, primarily employed as a research reagent. Its structure, derived from evidence, indicates a salt-like, multi-fragment organometallic compound containing iron, with features such as amine and ether functional groups and aromatic rings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 494227-37-1
(S)-(+)-N,N-Dimethyl-1-((R)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
(R)-(-)-N,N-Dimethyl-1-((S)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(bis(4-methoxy-3,5-bis(2-methyl-2-propanyl)phenyl)phosphine)
chiral ligand for asymmetric catalysis
(1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene
chiral ligand for asymmetric catalysis
(D-Lys16)-ACTH (1-24) (human, bovine, rat) trifluoroacetate salt
research reagent for receptor studies
2-fluoropyrazine
research compound
N-Hydroxybenzamide
analytical reagent and research compound
Indoline
research compound
HEJIDMKBSDYNOY-UHFFFAOYSA-N
CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.[Fe]