This compound is a boronic acid derivative of an indole, featuring a tert-butyloxycarbonyl (Boc) protecting group and a bromine substituent. It is primarily used as a pharmaceutical intermediate in chemical synthesis, facilitating the construction of more complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 475102-13-7
Methyl 2-chloroacetoacetate
Pharmaceutical intermediate for synthesis
1-boc-3-cyanopyrrolidine
pharmaceutical intermediate
5-BROMO-2-IODO-3-METHOXYPYRAZINE
Pharmaceutical intermediate
Boc-Tyr(2-Br-Z)-OH
Protected amino acid for peptide synthesis
[5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid
RBYTXZMVOGZESQ-UHFFFAOYSA-N
B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br)(O)O