Campesterin is a phytosterol compound found naturally in various plant oils such as rapeseed, soybean, and wheat germ oil. It is used as a food additive for its blood cholesterol-lowering properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 474-62-4
Cholesterol
emulsifying agent in pharmaceuticals and cosmetics
Cholenic acid
research compound
24(RS)-Hydroxycholesterol-d7
isotope-labeled research steroid standard
Glycocholic acid
Bile acid for fat absorption
Ellagic acid
antioxidant in cosmetics and nutraceuticals
Chlorophyll a
natural green colorant for food
N(alpha)-Lauroylarginine ethyl ester
antimicrobial surfactant
Cholesterol-26,26,26,27,27,27-d6
deuterated cholesterol internal standard
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
SGNBVLSWZMBQTH-PODYLUTMSA-N
C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C