9H-This compound is a selenium-containing heterocyclic compound featuring three fused aromatic rings and a selenoxanthenone core with a lone ketone group. It is supplied as a research reagent for laboratory-scale studies and investigation of its chemical properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4734-58-1
Methyl 1H-Indazole-5-carboxylate
research compound
3,5-DIBROMO-2-FLUOROPYRIDINE
research compound
Ethyltriphenylphosphonium iodide
research reagent
Pentylboronic acid
boronic acid research reagent
selenoxanthen-9-one
KNIBLZOPSUGNAP-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3[Se]2