4-(Trifluoromethyl)benzoic acid is an organic compound featuring a carboxylic acid group attached to a benzene ring that carries a trifluoromethyl substituent. It is commonly used as a research reagent in synthetic chemistry and materials science.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 455-24-3
3,5-Difluorobenzoic acid
Research reagent
4-Amino-3-fluorobenzoic acid
research compound
4-hydroxypyridine-d5
deuterated research reagent
LITHIUM-P-STYRENESULFONATE
Ion exchange monomer research
Sodium 4-(trifluoromethyl)benzoate
research compound
4-(trifluoromethyl)benzoic acid
SWKPKONEIZGROQ-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)C(F)(F)F