3,4,5-Trimethoxybenzoyl chloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of phenethylamine derivatives, including mescaline. It features an aromatic ring substituted with three methoxy groups and an acyl chloride group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4521-61-3
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
3,4,5-trimethoxybenzoyl chloride
BUHYMJLFRZAFBF-UHFFFAOYSA-N
COC1=CC(=CC(=C1OC)OC)C(=O)Cl