Tetrapropylammonium hydroxide is a quaternary ammonium compound commonly used as a structure-directing agent in the synthesis of zeolites. It serves as a precursor to important industrial and laboratory catalysts.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4499-86-9
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
Tetrapropylammonium bromide
Phase transfer catalyst and research reagent
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
Ethyl N~2~,N~6~-bis(oxomethylidene)-L-lysinate
diisocyanate monomer for polyurethane synthesis
2,5-Difluorotoluene
chemical intermediate for synthesis
tetrapropylazanium hydroxide
LPSKDVINWQNWFE-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[OH-]