5-Fluoro-2-nitroanisole is a chemical compound used as a research reagent. It is listed under California Proposition 65 as a substance known to the state to cause cancer or reproductive toxicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 448-19-1
(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid
research compound
(2R)-2-aminoheptanoic acid
research compound
(2S)-2-aminoheptanoic acid
research compound
1-Phenyl-1H-benzimidazol-2-yl hydrosulfide
research compound
4-fluoro-2-methoxy-1-nitrobenzene
WLKUSVNHZXUEFO-UHFFFAOYSA-N
COC1=C(C=CC(=C1)F)[N+](=O)[O-]