This compound is a pharmaceutical intermediate, specifically an acyl chloride derivative of an isoxazole ring. It is primarily used as a building block in the synthesis of other chemical compounds for research and manufacturing purposes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4462-55-9
3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for floxacrine analogues
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for drug synthesis
2-[(2R)-2-Hydroxy-3-[[4-(3-oxo-4-morpholinyl)phenyl]amino]propyl]-1H-isoindole-1,3(2H)-dione
rivaroxaban intermediate
2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione
intermediate for rivaroxaban synthesis
(S)-4-(4-(5-(AMINOMETHYL)-2-OXOOXAZOLIDIN-3-YL)PHENYL)MORPHOLIN-3-ONE
Rivaroxaban intermediate
Boronic acid, (6-(benzoylmethylamino)-5-methyl-3-pyridinyl)-
Pharmaceutical intermediate
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
IZQGELJKDARDMZ-UHFFFAOYSA-N
CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl