3-Oleoylestrone-2,4,16,16-D4 is a deuterated steroid compound used as a research standard. It features a steroid backbone with an oleic acid ester moiety and deuterium atoms at specific positions, making it suitable for analytical and investigative studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 443791-75-1
Diethyl (4-isopropyl-3,5-dimethoxybenzyl)phosphonate
Phosphonate building block for synthesis
2-Trifluoromethylphenol
pharmaceutical research reagent
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
(S)-Methyl 3-Amino-3-(4-methoxyphenyl)-propanoate Hydrochloride
research reagent
Climopax
conjugated estrogen active ingredient
(2,4,16,16-tetradeuterio-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate
IMIPDPVHGGHVNH-IXTWWMPWSA-N
[2H]C1=CC2=C(CCC3C2CCC4(C3CC(C4=O)([2H])[2H])C)C(=C1OC(=O)CCCCCCC/C=C\CCCCCCCC)[2H]